C25H28ClN3O2 — CID 138377357
(3E,5E)-1-(2-chloroacetyl)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one (PubChem CID 138377357) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is (3E,5E)-1-(2-chloroacetyl)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-(2-chloroacetyl)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 138377357 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | (3E,5E)-1-(2-chloroacetyl)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]piperidin-4-one |
| SMILES | CN(C)c1ccc(/C=C2\CN(C(=O)CCl)C/C(=C\c3ccc(N(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C25H28ClN3O2/c1-27(2)22-9-5-18(6-10-22)13-20-16-29(24(30)15-26)17-21(25(20)31)14-19-7-11-23(12-8-19)28(3)4/h5-14H,15-17H2,1-4H3/b20-13+,21-14+ |
| InChIKey | GVILIXCXDFORHL-KVVJQUGZSA-N |
| XLogP | 3.94 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|