C26H29N3O2 — CID 6478004
(3Z,5Z)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]-1-prop-2-enoylpiperidin-4-one (PubChem CID 6478004) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is (3Z,5Z)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]-1-prop-2-enoylpiperidin-4-one.
| Compound Name | (3Z,5Z)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]-1-prop-2-enoylpiperidin-4-one |
|---|---|
| PubChem CID | 6478004 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | (3Z,5Z)-3,5-bis[[4-(dimethylamino)phenyl]methylidene]-1-prop-2-enoylpiperidin-4-one |
| SMILES | C=CC(=O)N1C/C(=C/c2ccc(N(C)C)cc2)C(=O)/C(=C\c2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C26H29N3O2/c1-6-25(30)29-17-21(15-19-7-11-23(12-8-19)27(2)3)26(31)22(18-29)16-20-9-13-24(14-10-20)28(4)5/h6-16H,1,17-18H2,2-5H3/b21-15-,22-16- |
| InChIKey | KIJSWTZBZRWQNK-BMJUYKDLSA-N |
| XLogP | 3.88 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|