C26H30N2O4 — CID 139378323
(3E,5E)-1-[3-(dimethylamino)propanoyl]-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-4-one (PubChem CID 139378323) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is (3E,5E)-1-[3-(dimethylamino)propanoyl]-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-[3-(dimethylamino)propanoyl]-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 139378323 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | (3E,5E)-1-[3-(dimethylamino)propanoyl]-3,5-bis[(4-methoxyphenyl)methylidene]piperidin-4-one |
| SMILES | COc1ccc(/C=C2\CN(C(=O)CCN(C)C)C/C(=C\c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H30N2O4/c1-27(2)14-13-25(29)28-17-21(15-19-5-9-23(31-3)10-6-19)26(30)22(18-28)16-20-7-11-24(32-4)12-8-20/h5-12,15-16H,13-14,17-18H2,1-4H3/b21-15+,22-16+ |
| InChIKey | RHBXHJBQUFHBLG-YHARCJFQSA-N |
| XLogP | 3.53 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|