C25H22F4N2O3 — CID 166866884
1-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxopiperidin-1-yl]-4-(dimethylamino)butane-1,2-dione (PubChem CID 166866884) has the molecular formula C25H22F4N2O3 and a molecular weight of 474.45 g/mol. Its IUPAC name is 1-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxopiperidin-1-yl]-4-(dimethylamino)butane-1,2-dione.
| Compound Name | 1-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxopiperidin-1-yl]-4-(dimethylamino)butane-1,2-dione |
|---|---|
| PubChem CID | 166866884 |
| Molecular Formula | C25H22F4N2O3 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | 1-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxopiperidin-1-yl]-4-(dimethylamino)butane-1,2-dione |
| SMILES | CN(C)CCC(=O)C(=O)N1C/C(=C\c2ccc(F)c(F)c2)C(=O)/C(=C/c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C25H22F4N2O3/c1-30(2)8-7-23(32)25(34)31-13-17(9-15-3-5-19(26)21(28)11-15)24(33)18(14-31)10-16-4-6-20(27)22(29)12-16/h3-6,9-12H,7-8,13-14H2,1-2H3/b17-9+,18-10+ |
| InChIKey | HZLPSFNBUYJJHI-BEQMOXJMSA-N |
| XLogP | 3.64 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|