C31H28F4N2O3 — CID 139371322
N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(dimethylamino)ethoxy]benzamide (PubChem CID 139371322) has the molecular formula C31H28F4N2O3 and a molecular weight of 552.57 g/mol. Its IUPAC name is N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(dimethylamino)ethoxy]benzamide.
| Compound Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(dimethylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 139371322 |
| Molecular Formula | C31H28F4N2O3 |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(dimethylamino)ethoxy]benzamide |
| SMILES | CN(C)CCOc1ccc(C(=O)NC2C/C(=C\c3ccc(F)c(F)c3)C(=O)/C(=C/c3ccc(F)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C31H28F4N2O3/c1-37(2)11-12-40-25-7-5-21(6-8-25)31(39)36-24-17-22(13-19-3-9-26(32)28(34)15-19)30(38)23(18-24)14-20-4-10-27(33)29(35)16-20/h3-10,13-16,24H,11-12,17-18H2,1-2H3,(H,36,39)/b22-13+,23-14+ |
| InChIKey | PSYKEGJIMNAEOE-MSKUYSOUSA-N |
| XLogP | 5.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|