C34H33F4N3O5 — CID 171835366
N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[bis(2-methoxyethyl)carbamoylamino]benzamide (PubChem CID 171835366) has the molecular formula C34H33F4N3O5 and a molecular weight of 639.65 g/mol. Its IUPAC name is N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[bis(2-methoxyethyl)carbamoylamino]benzamide.
| Compound Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[bis(2-methoxyethyl)carbamoylamino]benzamide |
|---|---|
| PubChem CID | 171835366 |
| Molecular Formula | C34H33F4N3O5 |
| Molecular Weight | 639.65 g/mol |
| Exact Mass | 639.24 |
| IUPAC Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[bis(2-methoxyethyl)carbamoylamino]benzamide |
| SMILES | COCCN(CCOC)C(=O)Nc1ccc(C(=O)NC2C/C(=C\c3ccc(F)c(F)c3)C(=O)/C(=C/c3ccc(F)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C34H33F4N3O5/c1-45-13-11-41(12-14-46-2)34(44)40-26-7-5-23(6-8-26)33(43)39-27-19-24(15-21-3-9-28(35)30(37)17-21)32(42)25(20-27)16-22-4-10-29(36)31(38)18-22/h3-10,15-18,27H,11-14,19-20H2,1-2H3,(H,39,43)(H,40,44)/b24-15+,25-16+ |
| InChIKey | ZTYBDWXGGUIVSF-FEZYOMQXSA-N |
| XLogP | 6.00 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.65 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|