C35H32F4N2O5 — CID 171835207
4-[2-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)ethoxy]-N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]benzamide (PubChem CID 171835207) has the molecular formula C35H32F4N2O5 and a molecular weight of 636.64 g/mol. Its IUPAC name is 4-[2-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)ethoxy]-N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]benzamide.
| Compound Name | 4-[2-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)ethoxy]-N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]benzamide |
|---|---|
| PubChem CID | 171835207 |
| Molecular Formula | C35H32F4N2O5 |
| Molecular Weight | 636.64 g/mol |
| Exact Mass | 636.22 |
| IUPAC Name | 4-[2-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)ethoxy]-N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]benzamide |
| SMILES | O=C1/C(=C/c2ccc(F)c(F)c2)CC(NC(=O)c2ccc(OCCN3CC4OCCOC4C3)cc2)C/C1=C\c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C35H32F4N2O5/c36-28-7-1-21(15-30(28)38)13-24-17-26(18-25(34(24)42)14-22-2-8-29(37)31(39)16-22)40-35(43)23-3-5-27(6-4-23)44-10-9-41-19-32-33(20-41)46-12-11-45-32/h1-8,13-16,26,32-33H,9-12,17-20H2,(H,40,43)/b24-13+,25-14+ |
| InChIKey | QWGHLILEWGJCCG-GUJRAXHGSA-N |
| XLogP | 5.35 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|