C33H32F4N2O3 — CID 171835307
N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(butylamino)ethoxy]benzamide (PubChem CID 171835307) has the molecular formula C33H32F4N2O3 and a molecular weight of 580.62 g/mol. Its IUPAC name is N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(butylamino)ethoxy]benzamide.
| Compound Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(butylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 171835307 |
| Molecular Formula | C33H32F4N2O3 |
| Molecular Weight | 580.62 g/mol |
| Exact Mass | 580.23 |
| IUPAC Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(butylamino)ethoxy]benzamide |
| SMILES | CCCCNCCOc1ccc(C(=O)NC2C/C(=C\c3ccc(F)c(F)c3)C(=O)/C(=C/c3ccc(F)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C33H32F4N2O3/c1-2-3-12-38-13-14-42-27-8-6-23(7-9-27)33(41)39-26-19-24(15-21-4-10-28(34)30(36)17-21)32(40)25(20-26)16-22-5-11-29(35)31(37)18-22/h4-11,15-18,26,38H,2-3,12-14,19-20H2,1H3,(H,39,41)/b24-15+,25-16+ |
| InChIKey | OSJRXAWSEIHLRT-FEZYOMQXSA-N |
| XLogP | 6.64 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|