C33H31F5N2O3 — CID 139372028
N-[3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(diethylamino)ethoxy]-3-fluorobenzamide (PubChem CID 139372028) has the molecular formula C33H31F5N2O3 and a molecular weight of 598.61 g/mol. Its IUPAC name is N-[3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(diethylamino)ethoxy]-3-fluorobenzamide.
| Compound Name | N-[3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(diethylamino)ethoxy]-3-fluorobenzamide |
|---|---|
| PubChem CID | 139372028 |
| Molecular Formula | C33H31F5N2O3 |
| Molecular Weight | 598.61 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | N-[3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(diethylamino)ethoxy]-3-fluorobenzamide |
| SMILES | CCN(CC)CCOc1ccc(C(=O)NC2CC(=Cc3ccc(F)c(F)c3)C(=O)C(=Cc3ccc(F)c(F)c3)C2)cc1F |
| InChI | InChI=1S/C33H31F5N2O3/c1-3-40(4-2)11-12-43-31-10-7-22(19-30(31)38)33(42)39-25-17-23(13-20-5-8-26(34)28(36)15-20)32(41)24(18-25)14-21-6-9-27(35)29(37)16-21/h5-10,13-16,19,25H,3-4,11-12,17-18H2,1-2H3,(H,39,42) |
| InChIKey | VAWIZQITKPDKIV-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.61 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|