C39H36F4N2O3 — CID 171835472
N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[4-[2-(diethylamino)ethoxy]phenyl]benzamide (PubChem CID 171835472) has the molecular formula C39H36F4N2O3 and a molecular weight of 656.72 g/mol. Its IUPAC name is N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[4-[2-(diethylamino)ethoxy]phenyl]benzamide.
| Compound Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[4-[2-(diethylamino)ethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 171835472 |
| Molecular Formula | C39H36F4N2O3 |
| Molecular Weight | 656.72 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[4-[2-(diethylamino)ethoxy]phenyl]benzamide |
| SMILES | CCN(CC)CCOc1ccc(-c2ccc(C(=O)NC3C/C(=C\c4ccc(F)c(F)c4)C(=O)/C(=C/c4ccc(F)c(F)c4)C3)cc2)cc1 |
| InChI | InChI=1S/C39H36F4N2O3/c1-3-45(4-2)17-18-48-33-13-11-28(12-14-33)27-7-9-29(10-8-27)39(47)44-32-23-30(19-25-5-15-34(40)36(42)21-25)38(46)31(24-32)20-26-6-16-35(41)37(43)22-26/h5-16,19-22,32H,3-4,17-18,23-24H2,1-2H3,(H,44,47)/b30-19+,31-20+ |
| InChIKey | ZQZHZGMLXOVAQA-LVXWCJCWSA-N |
| XLogP | 8.26 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.72 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|