C32H30F4N2O2 — CID 170021095
N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[3-(dimethylamino)propyl]benzamide (PubChem CID 170021095) has the molecular formula C32H30F4N2O2 and a molecular weight of 550.60 g/mol. Its IUPAC name is N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[3-(dimethylamino)propyl]benzamide.
| Compound Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[3-(dimethylamino)propyl]benzamide |
|---|---|
| PubChem CID | 170021095 |
| Molecular Formula | C32H30F4N2O2 |
| Molecular Weight | 550.60 g/mol |
| Exact Mass | 550.22 |
| IUPAC Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[3-(dimethylamino)propyl]benzamide |
| SMILES | CN(C)CCCc1ccc(C(=O)NC2C/C(=C\c3ccc(F)c(F)c3)C(=O)/C(=C/c3ccc(F)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C32H30F4N2O2/c1-38(2)13-3-4-20-5-9-23(10-6-20)32(40)37-26-18-24(14-21-7-11-27(33)29(35)16-21)31(39)25(19-26)15-22-8-12-28(34)30(36)17-22/h5-12,14-17,26H,3-4,13,18-19H2,1-2H3,(H,37,40)/b24-14+,25-15+ |
| InChIKey | JXFQPPMXCZKFFP-KOJZRSEWSA-N |
| XLogP | 6.37 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.60 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|