C34H33F3N2O4 — CID 163740105
N-[(3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-4-oxocyclohexyl]-4-(2-morpholin-4-ylethoxy)benzamide (PubChem CID 163740105) has the molecular formula C34H33F3N2O4 and a molecular weight of 590.64 g/mol. Its IUPAC name is N-[(3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-4-oxocyclohexyl]-4-(2-morpholin-4-ylethoxy)benzamide.
| Compound Name | N-[(3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-4-oxocyclohexyl]-4-(2-morpholin-4-ylethoxy)benzamide |
|---|---|
| PubChem CID | 163740105 |
| Molecular Formula | C34H33F3N2O4 |
| Molecular Weight | 590.64 g/mol |
| Exact Mass | 590.24 |
| IUPAC Name | N-[(3E,5E)-3-[(3,4-difluorophenyl)methylidene]-5-[(4-fluoro-3-methylphenyl)methylidene]-4-oxocyclohexyl]-4-(2-morpholin-4-ylethoxy)benzamide |
| SMILES | Cc1cc(/C=C2\CC(NC(=O)c3ccc(OCCN4CCOCC4)cc3)C/C(=C\c3ccc(F)c(F)c3)C2=O)ccc1F |
| InChI | InChI=1S/C34H33F3N2O4/c1-22-16-23(2-8-30(22)35)17-26-20-28(21-27(33(26)40)18-24-3-9-31(36)32(37)19-24)38-34(41)25-4-6-29(7-5-25)43-15-12-39-10-13-42-14-11-39/h2-9,16-19,28H,10-15,20-21H2,1H3,(H,38,41)/b26-17+,27-18+ |
| InChIKey | OXUQPVUHFMRIIF-HEPXYTLMSA-N |
| XLogP | 5.75 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|