C41H48F4N2O3 — CID 171835314
N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(dihexylamino)ethoxy]benzamide (PubChem CID 171835314) has the molecular formula C41H48F4N2O3 and a molecular weight of 692.84 g/mol. Its IUPAC name is N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(dihexylamino)ethoxy]benzamide.
| Compound Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(dihexylamino)ethoxy]benzamide |
|---|---|
| PubChem CID | 171835314 |
| Molecular Formula | C41H48F4N2O3 |
| Molecular Weight | 692.84 g/mol |
| Exact Mass | 692.36 |
| IUPAC Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-[2-(dihexylamino)ethoxy]benzamide |
| SMILES | CCCCCCN(CCCCCC)CCOc1ccc(C(=O)NC2C/C(=C\c3ccc(F)c(F)c3)C(=O)/C(=C/c3ccc(F)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C41H48F4N2O3/c1-3-5-7-9-19-47(20-10-8-6-4-2)21-22-50-35-15-13-31(14-16-35)41(49)46-34-27-32(23-29-11-17-36(42)38(44)25-29)40(48)33(28-34)24-30-12-18-37(43)39(45)26-30/h11-18,23-26,34H,3-10,19-22,27-28H2,1-2H3,(H,46,49)/b32-23+,33-24+ |
| InChIKey | YIYTXFWRWYUEKB-GRSDYBEUSA-N |
| XLogP | 9.71 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.84 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|