C31H25F4N3O3 — CID 171835395
N-[4-[[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]carbamoyl]phenyl]azetidine-1-carboxamide (PubChem CID 171835395) has the molecular formula C31H25F4N3O3 and a molecular weight of 563.55 g/mol. Its IUPAC name is N-[4-[[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]carbamoyl]phenyl]azetidine-1-carboxamide.
| Compound Name | N-[4-[[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]carbamoyl]phenyl]azetidine-1-carboxamide |
|---|---|
| PubChem CID | 171835395 |
| Molecular Formula | C31H25F4N3O3 |
| Molecular Weight | 563.55 g/mol |
| Exact Mass | 563.18 |
| IUPAC Name | N-[4-[[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]carbamoyl]phenyl]azetidine-1-carboxamide |
| SMILES | O=C1/C(=C/c2ccc(F)c(F)c2)CC(NC(=O)c2ccc(NC(=O)N3CCC3)cc2)C/C1=C\c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C31H25F4N3O3/c32-25-8-2-18(14-27(25)34)12-21-16-24(17-22(29(21)39)13-19-3-9-26(33)28(35)15-19)36-30(40)20-4-6-23(7-5-20)37-31(41)38-10-1-11-38/h2-9,12-15,24H,1,10-11,16-17H2,(H,36,40)(H,37,41)/b21-12+,22-13+ |
| InChIKey | XXQCSRDNOGTIAT-ADYPVIEZSA-N |
| XLogP | 6.11 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.55 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|