C28H28F4N2O2 — CID 139371142
N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-3-piperidin-1-ylpropanamide (PubChem CID 139371142) has the molecular formula C28H28F4N2O2 and a molecular weight of 500.54 g/mol. Its IUPAC name is N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-3-piperidin-1-ylpropanamide.
| Compound Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-3-piperidin-1-ylpropanamide |
|---|---|
| PubChem CID | 139371142 |
| Molecular Formula | C28H28F4N2O2 |
| Molecular Weight | 500.54 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-3-piperidin-1-ylpropanamide |
| SMILES | O=C(CCN1CCCCC1)NC1C/C(=C\c2ccc(F)c(F)c2)C(=O)/C(=C/c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C28H28F4N2O2/c29-23-6-4-18(14-25(23)31)12-20-16-22(33-27(35)8-11-34-9-2-1-3-10-34)17-21(28(20)36)13-19-5-7-24(30)26(32)15-19/h4-7,12-15,22H,1-3,8-11,16-17H2,(H,33,35)/b20-12+,21-13+ |
| InChIKey | KPTZLURPMWGXBB-ZIOPAAQOSA-N |
| XLogP | 5.43 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|