C33H29ClF4N2O3 — CID 139378319
(3E,5E)-1-[3-chloro-4-(2-piperidin-1-ylethoxy)benzoyl]-3,5-bis[(3,4-difluorophenyl)methylidene]piperidin-4-one (PubChem CID 139378319) has the molecular formula C33H29ClF4N2O3 and a molecular weight of 613.05 g/mol. Its IUPAC name is (3E,5E)-1-[3-chloro-4-(2-piperidin-1-ylethoxy)benzoyl]-3,5-bis[(3,4-difluorophenyl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-[3-chloro-4-(2-piperidin-1-ylethoxy)benzoyl]-3,5-bis[(3,4-difluorophenyl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 139378319 |
| Molecular Formula | C33H29ClF4N2O3 |
| Molecular Weight | 613.05 g/mol |
| Exact Mass | 612.18 |
| IUPAC Name | (3E,5E)-1-[3-chloro-4-(2-piperidin-1-ylethoxy)benzoyl]-3,5-bis[(3,4-difluorophenyl)methylidene]piperidin-4-one |
| SMILES | O=C1/C(=C/c2ccc(F)c(F)c2)CN(C(=O)c2ccc(OCCN3CCCCC3)c(Cl)c2)C/C1=C\c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C33H29ClF4N2O3/c34-26-18-23(6-9-31(26)43-13-12-39-10-2-1-3-11-39)33(42)40-19-24(14-21-4-7-27(35)29(37)16-21)32(41)25(20-40)15-22-5-8-28(36)30(38)17-22/h4-9,14-18H,1-3,10-13,19-20H2/b24-14+,25-15+ |
| InChIKey | QPVGBITWNBLMEZ-KOJZRSEWSA-N |
| XLogP | 6.95 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.05 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|