C34H33Cl2NO3 — CID 86576856
(2E,6E)-2,6-bis[(4-chlorophenyl)methylidene]-4-[4-(2-piperidin-1-ylethoxy)benzoyl]cyclohexan-1-one (PubChem CID 86576856) has the molecular formula C34H33Cl2NO3 and a molecular weight of 574.55 g/mol. Its IUPAC name is (2E,6E)-2,6-bis[(4-chlorophenyl)methylidene]-4-[4-(2-piperidin-1-ylethoxy)benzoyl]cyclohexan-1-one.
| Compound Name | (2E,6E)-2,6-bis[(4-chlorophenyl)methylidene]-4-[4-(2-piperidin-1-ylethoxy)benzoyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 86576856 |
| Molecular Formula | C34H33Cl2NO3 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 573.18 |
| IUPAC Name | (2E,6E)-2,6-bis[(4-chlorophenyl)methylidene]-4-[4-(2-piperidin-1-ylethoxy)benzoyl]cyclohexan-1-one |
| SMILES | O=C1/C(=C/c2ccc(Cl)cc2)CC(C(=O)c2ccc(OCCN3CCCCC3)cc2)C/C1=C\c1ccc(Cl)cc1 |
| InChI | InChI=1S/C34H33Cl2NO3/c35-30-10-4-24(5-11-30)20-27-22-29(23-28(34(27)39)21-25-6-12-31(36)13-7-25)33(38)26-8-14-32(15-9-26)40-19-18-37-16-2-1-3-17-37/h4-15,20-21,29H,1-3,16-19,22-23H2/b27-20+,28-21+ |
| InChIKey | YAZAQZZWOSHKEB-KUKFKUQFSA-N |
| XLogP | 8.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|