C33H35NO3 — CID 86576943
(2E,6E)-4-[4-[2-(dimethylamino)ethoxy]benzoyl]-2,6-bis[(4-methylphenyl)methylidene]cyclohexan-1-one (PubChem CID 86576943) has the molecular formula C33H35NO3 and a molecular weight of 493.65 g/mol. Its IUPAC name is (2E,6E)-4-[4-[2-(dimethylamino)ethoxy]benzoyl]-2,6-bis[(4-methylphenyl)methylidene]cyclohexan-1-one.
| Compound Name | (2E,6E)-4-[4-[2-(dimethylamino)ethoxy]benzoyl]-2,6-bis[(4-methylphenyl)methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 86576943 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (2E,6E)-4-[4-[2-(dimethylamino)ethoxy]benzoyl]-2,6-bis[(4-methylphenyl)methylidene]cyclohexan-1-one |
| SMILES | Cc1ccc(/C=C2\CC(C(=O)c3ccc(OCCN(C)C)cc3)C/C(=C\c3ccc(C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C33H35NO3/c1-23-5-9-25(10-6-23)19-28-21-30(22-29(33(28)36)20-26-11-7-24(2)8-12-26)32(35)27-13-15-31(16-14-27)37-18-17-34(3)4/h5-16,19-20,30H,17-18,21-22H2,1-4H3/b28-19+,29-20+ |
| InChIKey | GQNLVVBVGPVOAL-JUWMQZRYSA-N |
| XLogP | 6.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|