C27H27Cl2NO — CID 155812406
1-[2-[4-[(Z)-1,2-bis(4-chlorophenyl)prop-1-enyl]phenoxy]ethyl]pyrrolidine (PubChem CID 155812406) has the molecular formula C27H27Cl2NO and a molecular weight of 452.43 g/mol. Its IUPAC name is 1-[2-[4-[(Z)-1,2-bis(4-chlorophenyl)prop-1-enyl]phenoxy]ethyl]pyrrolidine.
| Compound Name | 1-[2-[4-[(Z)-1,2-bis(4-chlorophenyl)prop-1-enyl]phenoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 155812406 |
| Molecular Formula | C27H27Cl2NO |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 1-[2-[4-[(Z)-1,2-bis(4-chlorophenyl)prop-1-enyl]phenoxy]ethyl]pyrrolidine |
| SMILES | C/C(=C(/c1ccc(Cl)cc1)c1ccc(OCCN2CCCC2)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H27Cl2NO/c1-20(21-4-10-24(28)11-5-21)27(22-6-12-25(29)13-7-22)23-8-14-26(15-9-23)31-19-18-30-16-2-3-17-30/h4-15H,2-3,16-19H2,1H3/b27-20+ |
| InChIKey | JZJVRWWQOOBJPJ-NHFJDJAPSA-N |
| XLogP | 7.45 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|