C27H28ClNO — CID 155806165
1-[2-[4-[(Z)-1-(4-chlorophenyl)-2-phenylprop-1-enyl]phenoxy]ethyl]pyrrolidine (PubChem CID 155806165) has the molecular formula C27H28ClNO and a molecular weight of 417.98 g/mol. Its IUPAC name is 1-[2-[4-[(Z)-1-(4-chlorophenyl)-2-phenylprop-1-enyl]phenoxy]ethyl]pyrrolidine.
| Compound Name | 1-[2-[4-[(Z)-1-(4-chlorophenyl)-2-phenylprop-1-enyl]phenoxy]ethyl]pyrrolidine |
|---|---|
| PubChem CID | 155806165 |
| Molecular Formula | C27H28ClNO |
| Molecular Weight | 417.98 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 1-[2-[4-[(Z)-1-(4-chlorophenyl)-2-phenylprop-1-enyl]phenoxy]ethyl]pyrrolidine |
| SMILES | C/C(=C(/c1ccc(Cl)cc1)c1ccc(OCCN2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C27H28ClNO/c1-21(22-7-3-2-4-8-22)27(23-9-13-25(28)14-10-23)24-11-15-26(16-12-24)30-20-19-29-17-5-6-18-29/h2-4,7-16H,5-6,17-20H2,1H3/b27-21+ |
| InChIKey | KVSVHYYEVWAPGT-SZXQPVLSSA-N |
| XLogP | 6.79 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.98 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|