C30H35NO3 — CID 171935752
4-[(E)-1-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-(4-methoxyphenyl)prop-1-enyl]phenol (PubChem CID 171935752) has the molecular formula C30H35NO3 and a molecular weight of 457.61 g/mol. Its IUPAC name is 4-[(E)-1-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-(4-methoxyphenyl)prop-1-enyl]phenol.
| Compound Name | 4-[(E)-1-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-(4-methoxyphenyl)prop-1-enyl]phenol |
|---|---|
| PubChem CID | 171935752 |
| Molecular Formula | C30H35NO3 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 4-[(E)-1-[4-[2-(azepan-1-yl)ethoxy]phenyl]-2-(4-methoxyphenyl)prop-1-enyl]phenol |
| SMILES | COc1ccc(/C(C)=C(\c2ccc(O)cc2)c2ccc(OCCN3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C30H35NO3/c1-23(24-9-15-28(33-2)16-10-24)30(25-7-13-27(32)14-8-25)26-11-17-29(18-12-26)34-22-21-31-19-5-3-4-6-20-31/h7-18,32H,3-6,19-22H2,1-2H3/b30-23+ |
| InChIKey | RAYMETVNRDYIMR-JJKYIXSRSA-N |
| XLogP | 6.63 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|