C32H33NO3 — CID 11784901
5-[(E)-1-(4-methoxyphenyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]prop-1-enyl]naphthalen-2-ol (PubChem CID 11784901) has the molecular formula C32H33NO3 and a molecular weight of 479.62 g/mol. Its IUPAC name is 5-[(E)-1-(4-methoxyphenyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]prop-1-enyl]naphthalen-2-ol.
| Compound Name | 5-[(E)-1-(4-methoxyphenyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]prop-1-enyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 11784901 |
| Molecular Formula | C32H33NO3 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 5-[(E)-1-(4-methoxyphenyl)-2-[4-(2-pyrrolidin-1-ylethoxy)phenyl]prop-1-enyl]naphthalen-2-ol |
| SMILES | COc1ccc(/C(=C(/C)c2ccc(OCCN3CCCC3)cc2)c2cccc3cc(O)ccc23)cc1 |
| InChI | InChI=1S/C32H33NO3/c1-23(24-8-15-29(16-9-24)36-21-20-33-18-3-4-19-33)32(25-10-13-28(35-2)14-11-25)31-7-5-6-26-22-27(34)12-17-30(26)31/h5-17,22,34H,3-4,18-21H2,1-2H3/b32-23+ |
| InChIKey | LLUTZIPMKGJQEK-AWSUPERCSA-N |
| XLogP | 7.01 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|