C31H31NO3 — CID 11454084
5-[(E)-2-(4-hydroxyphenyl)-2-[4-(2-piperidin-1-ylethoxy)phenyl]ethenyl]naphthalen-2-ol (PubChem CID 11454084) has the molecular formula C31H31NO3 and a molecular weight of 465.59 g/mol. Its IUPAC name is 5-[(E)-2-(4-hydroxyphenyl)-2-[4-(2-piperidin-1-ylethoxy)phenyl]ethenyl]naphthalen-2-ol.
| Compound Name | 5-[(E)-2-(4-hydroxyphenyl)-2-[4-(2-piperidin-1-ylethoxy)phenyl]ethenyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 11454084 |
| Molecular Formula | C31H31NO3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 5-[(E)-2-(4-hydroxyphenyl)-2-[4-(2-piperidin-1-ylethoxy)phenyl]ethenyl]naphthalen-2-ol |
| SMILES | Oc1ccc(/C(=C\c2cccc3cc(O)ccc23)c2ccc(OCCN3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H31NO3/c33-27-11-7-23(8-12-27)31(22-26-6-4-5-25-21-28(34)13-16-30(25)26)24-9-14-29(15-10-24)35-20-19-32-17-2-1-3-18-32/h4-16,21-22,33-34H,1-3,17-20H2/b31-22+ |
| InChIKey | KHMZXQUNINYENE-DFKUXCBWSA-N |
| XLogP | 6.70 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|