C30H29NO5 — CID 19362234
[2-(3,4-dihydroxyphenyl)-6-hydroxynaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone (PubChem CID 19362234) has the molecular formula C30H29NO5 and a molecular weight of 483.56 g/mol. Its IUPAC name is [2-(3,4-dihydroxyphenyl)-6-hydroxynaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone.
| Compound Name | [2-(3,4-dihydroxyphenyl)-6-hydroxynaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 19362234 |
| Molecular Formula | C30H29NO5 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | [2-(3,4-dihydroxyphenyl)-6-hydroxynaphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCCN2CCCCC2)cc1)c1c(-c2ccc(O)c(O)c2)ccc2cc(O)ccc12 |
| InChI | InChI=1S/C30H29NO5/c32-23-8-12-26-21(18-23)6-11-25(22-7-13-27(33)28(34)19-22)29(26)30(35)20-4-9-24(10-5-20)36-17-16-31-14-2-1-3-15-31/h4-13,18-19,32-34H,1-3,14-17H2 |
| InChIKey | AIGYNHIQTMRBSL-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|