C30H26F3NO3 — CID 11237470
[6-hydroxy-2-(2,3,5-trifluorophenyl)naphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone (PubChem CID 11237470) has the molecular formula C30H26F3NO3 and a molecular weight of 505.54 g/mol. Its IUPAC name is [6-hydroxy-2-(2,3,5-trifluorophenyl)naphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone.
| Compound Name | [6-hydroxy-2-(2,3,5-trifluorophenyl)naphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 11237470 |
| Molecular Formula | C30H26F3NO3 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | [6-hydroxy-2-(2,3,5-trifluorophenyl)naphthalen-1-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OCCN2CCCCC2)cc1)c1c(-c2cc(F)cc(F)c2F)ccc2cc(O)ccc12 |
| InChI | InChI=1S/C30H26F3NO3/c31-21-17-26(29(33)27(32)18-21)25-10-6-20-16-22(35)7-11-24(20)28(25)30(36)19-4-8-23(9-5-19)37-15-14-34-12-2-1-3-13-34/h4-11,16-18,35H,1-3,12-15H2 |
| InChIKey | LKUMXVRHPHWJPN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|