C38H45NO8S2 — CID 19362226
[6-(3-butylsulfonyloxyphenyl)-5-[4-(2-piperidin-1-ylethoxy)benzoyl]naphthalen-2-yl] butane-1-sulfonate (PubChem CID 19362226) has the molecular formula C38H45NO8S2 and a molecular weight of 707.91 g/mol. Its IUPAC name is [6-(3-butylsulfonyloxyphenyl)-5-[4-(2-piperidin-1-ylethoxy)benzoyl]naphthalen-2-yl] butane-1-sulfonate.
| Compound Name | [6-(3-butylsulfonyloxyphenyl)-5-[4-(2-piperidin-1-ylethoxy)benzoyl]naphthalen-2-yl] butane-1-sulfonate |
|---|---|
| PubChem CID | 19362226 |
| Molecular Formula | C38H45NO8S2 |
| Molecular Weight | 707.91 g/mol |
| Exact Mass | 707.26 |
| IUPAC Name | [6-(3-butylsulfonyloxyphenyl)-5-[4-(2-piperidin-1-ylethoxy)benzoyl]naphthalen-2-yl] butane-1-sulfonate |
| SMILES | CCCCS(=O)(=O)Oc1cccc(-c2ccc3cc(OS(=O)(=O)CCCC)ccc3c2C(=O)c2ccc(OCCN3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C38H45NO8S2/c1-3-5-25-48(41,42)46-33-12-10-11-30(27-33)35-19-15-31-28-34(47-49(43,44)26-6-4-2)18-20-36(31)37(35)38(40)29-13-16-32(17-14-29)45-24-23-39-21-8-7-9-22-39/h10-20,27-28H,3-9,21-26H2,1-2H3 |
| InChIKey | ZMZKXSKOUYRCKX-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.91 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|