C38H47NO6S3 — CID 18357250
[6-pentylsulfonyl-2-(4-pentylsulfonylphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone (PubChem CID 18357250) has the molecular formula C38H47NO6S3 and a molecular weight of 710.00 g/mol. Its IUPAC name is [6-pentylsulfonyl-2-(4-pentylsulfonylphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone.
| Compound Name | [6-pentylsulfonyl-2-(4-pentylsulfonylphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 18357250 |
| Molecular Formula | C38H47NO6S3 |
| Molecular Weight | 710.00 g/mol |
| Exact Mass | 709.26 |
| IUPAC Name | [6-pentylsulfonyl-2-(4-pentylsulfonylphenyl)-1-benzothiophen-3-yl]-[4-(2-piperidin-1-ylethoxy)phenyl]methanone |
| SMILES | CCCCCS(=O)(=O)c1ccc(-c2sc3cc(S(=O)(=O)CCCCC)ccc3c2C(=O)c2ccc(OCCN3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C38H47NO6S3/c1-3-5-10-26-47(41,42)32-18-14-30(15-19-32)38-36(34-21-20-33(28-35(34)46-38)48(43,44)27-11-6-4-2)37(40)29-12-16-31(17-13-29)45-25-24-39-22-8-7-9-23-39/h12-21,28H,3-11,22-27H2,1-2H3 |
| InChIKey | BUTBEWXLQVDMBT-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 97.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.00 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|