C31H36N2O3 — CID 155816458
[4-[(E)-2-phenyl-1-[4-(2-piperidin-1-ylethoxy)phenyl]prop-1-enyl]phenyl] N-ethylcarbamate (PubChem CID 155816458) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is [4-[(E)-2-phenyl-1-[4-(2-piperidin-1-ylethoxy)phenyl]prop-1-enyl]phenyl] N-ethylcarbamate.
| Compound Name | [4-[(E)-2-phenyl-1-[4-(2-piperidin-1-ylethoxy)phenyl]prop-1-enyl]phenyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 155816458 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | [4-[(E)-2-phenyl-1-[4-(2-piperidin-1-ylethoxy)phenyl]prop-1-enyl]phenyl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1ccc(/C(=C(\C)c2ccccc2)c2ccc(OCCN3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C31H36N2O3/c1-3-32-31(34)36-29-18-14-27(15-19-29)30(24(2)25-10-6-4-7-11-25)26-12-16-28(17-13-26)35-23-22-33-20-8-5-9-21-33/h4,6-7,10-19H,3,5,8-9,20-23H2,1-2H3,(H,32,34)/b30-24+ |
| InChIKey | DGTFBJPZVUBHGW-BGABXYSRSA-N |
| XLogP | 6.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|