C25H22F4N2O2 — CID 139371808
(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-(1-methylpyrrolidine-3-carbonyl)piperidin-4-one (PubChem CID 139371808) has the molecular formula C25H22F4N2O2 and a molecular weight of 458.46 g/mol. Its IUPAC name is (3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-(1-methylpyrrolidine-3-carbonyl)piperidin-4-one.
| Compound Name | (3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-(1-methylpyrrolidine-3-carbonyl)piperidin-4-one |
|---|---|
| PubChem CID | 139371808 |
| Molecular Formula | C25H22F4N2O2 |
| Molecular Weight | 458.46 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | (3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-1-(1-methylpyrrolidine-3-carbonyl)piperidin-4-one |
| SMILES | CN1CCC(C(=O)N2C/C(=C\c3ccc(F)c(F)c3)C(=O)/C(=C/c3ccc(F)c(F)c3)C2)C1 |
| InChI | InChI=1S/C25H22F4N2O2/c1-30-7-6-17(12-30)25(33)31-13-18(8-15-2-4-20(26)22(28)10-15)24(32)19(14-31)9-16-3-5-21(27)23(29)11-16/h2-5,8-11,17H,6-7,12-14H2,1H3/b18-8+,19-9+ |
| InChIKey | PUVPBSSUOFTWPS-GCBPPVMSSA-N |
| XLogP | 4.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|