C33H30F4N4O3 — CID 171835292
2-amino-1-N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-N,4-N-diethyl-3-methanimidoylbenzene-1,4-dicarboxamide (PubChem CID 171835292) has the molecular formula C33H30F4N4O3 and a molecular weight of 606.62 g/mol. Its IUPAC name is 2-amino-1-N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-N,4-N-diethyl-3-methanimidoylbenzene-1,4-dicarboxamide.
| Compound Name | 2-amino-1-N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-N,4-N-diethyl-3-methanimidoylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 171835292 |
| Molecular Formula | C33H30F4N4O3 |
| Molecular Weight | 606.62 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 2-amino-1-N-[(3E,5E)-3,5-bis[(3,4-difluorophenyl)methylidene]-4-oxocyclohexyl]-4-N,4-N-diethyl-3-methanimidoylbenzene-1,4-dicarboxamide |
| SMILES | [H]/N=C/c1c(C(=O)N(CC)CC)ccc(C(=O)NC2C/C(=C\c3ccc(F)c(F)c3)C(=O)/C(=C/c3ccc(F)c(F)c3)C2)c1N |
| InChI | InChI=1S/C33H30F4N4O3/c1-3-41(4-2)33(44)23-7-8-24(30(39)25(23)17-38)32(43)40-22-15-20(11-18-5-9-26(34)28(36)13-18)31(42)21(16-22)12-19-6-10-27(35)29(37)14-19/h5-14,17,22,38H,3-4,15-16,39H2,1-2H3,(H,40,43)/b20-11+,21-12+,38-17+ |
| InChIKey | ZOMKTCUNSJUORF-VWYAFKAUSA-N |
| XLogP | 5.93 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|