C15H12OS3 — CID 47006177
(3E,5Z)-3,5-bis(thiophen-3-ylmethylidene)thian-4-one (PubChem CID 47006177) has the molecular formula C15H12OS3 and a molecular weight of 304.46 g/mol. Its IUPAC name is (3E,5Z)-3,5-bis(thiophen-3-ylmethylidene)thian-4-one.
| Compound Name | (3E,5Z)-3,5-bis(thiophen-3-ylmethylidene)thian-4-one |
|---|---|
| PubChem CID | 47006177 |
| Molecular Formula | C15H12OS3 |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | (3E,5Z)-3,5-bis(thiophen-3-ylmethylidene)thian-4-one |
| SMILES | O=C1/C(=C/c2ccsc2)CSC/C1=C/c1ccsc1 |
| InChI | InChI=1S/C15H12OS3/c16-15-13(5-11-1-3-17-7-11)9-19-10-14(15)6-12-2-4-18-8-12/h1-8H,9-10H2/b13-5-,14-6+ |
| InChIKey | FGVZVWVANXBFDY-FUJGBLOQSA-N |
| XLogP | 4.59 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|