C27H30Br2O3S — CID 118099439
(3Z,5Z)-3,5-bis[(3-bromo-2-butoxyphenyl)methylidene]thian-4-one (PubChem CID 118099439) has the molecular formula C27H30Br2O3S and a molecular weight of 594.41 g/mol. Its IUPAC name is (3Z,5Z)-3,5-bis[(3-bromo-2-butoxyphenyl)methylidene]thian-4-one.
| Compound Name | (3Z,5Z)-3,5-bis[(3-bromo-2-butoxyphenyl)methylidene]thian-4-one |
|---|---|
| PubChem CID | 118099439 |
| Molecular Formula | C27H30Br2O3S |
| Molecular Weight | 594.41 g/mol |
| Exact Mass | 592.03 |
| IUPAC Name | (3Z,5Z)-3,5-bis[(3-bromo-2-butoxyphenyl)methylidene]thian-4-one |
| SMILES | CCCCOc1c(Br)cccc1/C=C1\CSC/C(=C\c2cccc(Br)c2OCCCC)C1=O |
| InChI | InChI=1S/C27H30Br2O3S/c1-3-5-13-31-26-19(9-7-11-23(26)28)15-21-17-33-18-22(25(21)30)16-20-10-8-12-24(29)27(20)32-14-6-4-2/h7-12,15-16H,3-6,13-14,17-18H2,1-2H3/b21-15+,22-16+ |
| InChIKey | SDQCHIGIAQOIJZ-YHARCJFQSA-N |
| XLogP | 8.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.41 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|