C14H17BrO5S — CID 106726652
(E)-3-[3-bromo-2-(2-propylsulfonylethoxy)phenyl]prop-2-enoic acid (PubChem CID 106726652) has the molecular formula C14H17BrO5S and a molecular weight of 377.26 g/mol. Its IUPAC name is (E)-3-[3-bromo-2-(2-propylsulfonylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-bromo-2-(2-propylsulfonylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106726652 |
| Molecular Formula | C14H17BrO5S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 376.00 |
| IUPAC Name | (E)-3-[3-bromo-2-(2-propylsulfonylethoxy)phenyl]prop-2-enoic acid |
| SMILES | CCCS(=O)(=O)CCOc1c(Br)cccc1/C=C/C(=O)O |
| InChI | InChI=1S/C14H17BrO5S/c1-2-9-21(18,19)10-8-20-14-11(6-7-13(16)17)4-3-5-12(14)15/h3-7H,2,8-10H2,1H3,(H,16,17)/b7-6+ |
| InChIKey | AYXJDFVJIFIDLP-VOTSOKGWSA-N |
| XLogP | 2.75 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|