C11H11BrO3 — CID 61392204
3-(3-bromo-2-ethoxyphenyl)prop-2-enoic acid (PubChem CID 61392204) has the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. Its IUPAC name is 3-(3-bromo-2-ethoxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(3-bromo-2-ethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 61392204 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | 3-(3-bromo-2-ethoxyphenyl)prop-2-enoic acid |
| SMILES | CCOc1c(Br)cccc1C=CC(=O)O |
| InChI | InChI=1S/C11H11BrO3/c1-2-15-11-8(6-7-10(13)14)4-3-5-9(11)12/h3-7H,2H2,1H3,(H,13,14) |
| InChIKey | YRKYIWFGGQWFBK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|