C15H18BrNO4 — CID 76899357
3-[3-bromo-2-[2-(tert-butylamino)-2-oxoethoxy]phenyl]prop-2-enoic acid (PubChem CID 76899357) has the molecular formula C15H18BrNO4 and a molecular weight of 356.22 g/mol. Its IUPAC name is 3-[3-bromo-2-[2-(tert-butylamino)-2-oxoethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-bromo-2-[2-(tert-butylamino)-2-oxoethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76899357 |
| Molecular Formula | C15H18BrNO4 |
| Molecular Weight | 356.22 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 3-[3-bromo-2-[2-(tert-butylamino)-2-oxoethoxy]phenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)NC(=O)COc1c(Br)cccc1C=CC(=O)O |
| InChI | InChI=1S/C15H18BrNO4/c1-15(2,3)17-12(18)9-21-14-10(7-8-13(19)20)5-4-6-11(14)16/h4-8H,9H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | TWBFTNVIKQPBGQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.22 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|