C15H17BrO5 — CID 79621059
3-[3-bromo-2-(3-methoxy-2,2-dimethyl-3-oxopropoxy)phenyl]prop-2-enoic acid (PubChem CID 79621059) has the molecular formula C15H17BrO5 and a molecular weight of 357.20 g/mol. Its IUPAC name is 3-[3-bromo-2-(3-methoxy-2,2-dimethyl-3-oxopropoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-bromo-2-(3-methoxy-2,2-dimethyl-3-oxopropoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 79621059 |
| Molecular Formula | C15H17BrO5 |
| Molecular Weight | 357.20 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 3-[3-bromo-2-(3-methoxy-2,2-dimethyl-3-oxopropoxy)phenyl]prop-2-enoic acid |
| SMILES | COC(=O)C(C)(C)COc1c(Br)cccc1C=CC(=O)O |
| InChI | InChI=1S/C15H17BrO5/c1-15(2,14(19)20-3)9-21-13-10(7-8-12(17)18)5-4-6-11(13)16/h4-8H,9H2,1-3H3,(H,17,18) |
| InChIKey | DDOHEWKNLRMEGI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|