C14H17BrO2 — CID 146417505
methyl (E)-5-(2-bromophenyl)-2,2-dimethylpent-4-enoate (PubChem CID 146417505) has the molecular formula C14H17BrO2 and a molecular weight of 297.19 g/mol. Its IUPAC name is methyl (E)-5-(2-bromophenyl)-2,2-dimethylpent-4-enoate.
| Compound Name | methyl (E)-5-(2-bromophenyl)-2,2-dimethylpent-4-enoate |
|---|---|
| PubChem CID | 146417505 |
| Molecular Formula | C14H17BrO2 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | methyl (E)-5-(2-bromophenyl)-2,2-dimethylpent-4-enoate |
| SMILES | COC(=O)C(C)(C)C/C=C/c1ccccc1Br |
| InChI | InChI=1S/C14H17BrO2/c1-14(2,13(16)17-3)10-6-8-11-7-4-5-9-12(11)15/h4-9H,10H2,1-3H3/b8-6+ |
| InChIKey | KHGIYPPGGKEKBY-SOFGYWHQSA-N |
| XLogP | 4.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |