C12H15BrO3S — CID 79620621
methyl 3-(2-bromophenyl)sulfinyl-2,2-dimethylpropanoate (PubChem CID 79620621) has the molecular formula C12H15BrO3S and a molecular weight of 319.22 g/mol. Its IUPAC name is methyl 3-(2-bromophenyl)sulfinyl-2,2-dimethylpropanoate.
| Compound Name | methyl 3-(2-bromophenyl)sulfinyl-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 79620621 |
| Molecular Formula | C12H15BrO3S |
| Molecular Weight | 319.22 g/mol |
| Exact Mass | 317.99 |
| IUPAC Name | methyl 3-(2-bromophenyl)sulfinyl-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)CS(=O)c1ccccc1Br |
| InChI | InChI=1S/C12H15BrO3S/c1-12(2,11(14)16-3)8-17(15)10-7-5-4-6-9(10)13/h4-7H,8H2,1-3H3 |
| InChIKey | JNQWXNBEOBANSO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |