C12H13ClO5S — CID 112614390
(E)-3-[3-chloro-2-(2-methylsulfonylethoxy)phenyl]prop-2-enoic acid (PubChem CID 112614390) has the molecular formula C12H13ClO5S and a molecular weight of 304.75 g/mol. Its IUPAC name is (E)-3-[3-chloro-2-(2-methylsulfonylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-2-(2-methylsulfonylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 112614390 |
| Molecular Formula | C12H13ClO5S |
| Molecular Weight | 304.75 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (E)-3-[3-chloro-2-(2-methylsulfonylethoxy)phenyl]prop-2-enoic acid |
| SMILES | CS(=O)(=O)CCOc1c(Cl)cccc1/C=C/C(=O)O |
| InChI | InChI=1S/C12H13ClO5S/c1-19(16,17)8-7-18-12-9(5-6-11(14)15)3-2-4-10(12)13/h2-6H,7-8H2,1H3,(H,14,15)/b6-5+ |
| InChIKey | VHZTVPDNFUTIFJ-AATRIKPKSA-N |
| XLogP | 1.86 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.75 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|