C14H10BrClO3S — CID 115957098
(E)-3-[2-[(4-bromothiophen-2-yl)methoxy]-3-chlorophenyl]prop-2-enoic acid (PubChem CID 115957098) has the molecular formula C14H10BrClO3S and a molecular weight of 373.66 g/mol. Its IUPAC name is (E)-3-[2-[(4-bromothiophen-2-yl)methoxy]-3-chlorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(4-bromothiophen-2-yl)methoxy]-3-chlorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115957098 |
| Molecular Formula | C14H10BrClO3S |
| Molecular Weight | 373.66 g/mol |
| Exact Mass | 371.92 |
| IUPAC Name | (E)-3-[2-[(4-bromothiophen-2-yl)methoxy]-3-chlorophenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1cccc(Cl)c1OCc1cc(Br)cs1 |
| InChI | InChI=1S/C14H10BrClO3S/c15-10-6-11(20-8-10)7-19-14-9(4-5-13(17)18)2-1-3-12(14)16/h1-6,8H,7H2,(H,17,18)/b5-4+ |
| InChIKey | KRPLSTKJPYOCQF-SNAWJCMRSA-N |
| XLogP | 4.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.66 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|