C14H10Cl2O3S — CID 76918916
3-[5-[(2,3-dichlorophenoxy)methyl]thiophen-3-yl]prop-2-enoic acid (PubChem CID 76918916) has the molecular formula C14H10Cl2O3S and a molecular weight of 329.20 g/mol. Its IUPAC name is 3-[5-[(2,3-dichlorophenoxy)methyl]thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[(2,3-dichlorophenoxy)methyl]thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76918916 |
| Molecular Formula | C14H10Cl2O3S |
| Molecular Weight | 329.20 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 3-[5-[(2,3-dichlorophenoxy)methyl]thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1csc(COc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C14H10Cl2O3S/c15-11-2-1-3-12(14(11)16)19-7-10-6-9(8-20-10)4-5-13(17)18/h1-6,8H,7H2,(H,17,18) |
| InChIKey | DHZQDUCWHJYTFT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.20 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|