C15H13ClO3S — CID 114321202
(E)-3-[2-chloro-6-(2-thiophen-2-ylethoxy)phenyl]prop-2-enoic acid (PubChem CID 114321202) has the molecular formula C15H13ClO3S and a molecular weight of 308.79 g/mol. Its IUPAC name is (E)-3-[2-chloro-6-(2-thiophen-2-ylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-chloro-6-(2-thiophen-2-ylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 114321202 |
| Molecular Formula | C15H13ClO3S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | (E)-3-[2-chloro-6-(2-thiophen-2-ylethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1c(Cl)cccc1OCCc1cccs1 |
| InChI | InChI=1S/C15H13ClO3S/c16-13-4-1-5-14(12(13)6-7-15(17)18)19-9-8-11-3-2-10-20-11/h1-7,10H,8-9H2,(H,17,18)/b7-6+ |
| InChIKey | BWLMAXKIPVOKCK-VOTSOKGWSA-N |
| XLogP | 4.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|