C13H11ClO3 — CID 114321169
(E)-3-(2-but-3-ynoxy-6-chlorophenyl)prop-2-enoic acid (PubChem CID 114321169) has the molecular formula C13H11ClO3 and a molecular weight of 250.68 g/mol. Its IUPAC name is (E)-3-(2-but-3-ynoxy-6-chlorophenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(2-but-3-ynoxy-6-chlorophenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 114321169 |
| Molecular Formula | C13H11ClO3 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | (E)-3-(2-but-3-ynoxy-6-chlorophenyl)prop-2-enoic acid |
| SMILES | C#CCCOc1cccc(Cl)c1/C=C/C(=O)O |
| InChI | InChI=1S/C13H11ClO3/c1-2-3-9-17-12-6-4-5-11(14)10(12)7-8-13(15)16/h1,4-8H,3,9H2,(H,15,16)/b8-7+ |
| InChIKey | KDIMEJHMVIQPKW-BQYQJAHWSA-N |
| XLogP | 2.84 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|