C15H9Cl3O3 — CID 43622101
(E)-3-[2-chloro-6-(3,5-dichlorophenoxy)phenyl]prop-2-enoic acid (PubChem CID 43622101) has the molecular formula C15H9Cl3O3 and a molecular weight of 343.59 g/mol. Its IUPAC name is (E)-3-[2-chloro-6-(3,5-dichlorophenoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-chloro-6-(3,5-dichlorophenoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43622101 |
| Molecular Formula | C15H9Cl3O3 |
| Molecular Weight | 343.59 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | (E)-3-[2-chloro-6-(3,5-dichlorophenoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1c(Cl)cccc1Oc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H9Cl3O3/c16-9-6-10(17)8-11(7-9)21-14-3-1-2-13(18)12(14)4-5-15(19)20/h1-8H,(H,19,20)/b5-4+ |
| InChIKey | WWPYSKPLIJLVMD-SNAWJCMRSA-N |
| XLogP | 5.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.59 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|