C17H12Cl2O3 — CID 54370728
5-[3-(3,5-dichlorophenoxy)phenyl]penta-2,4-dienoic acid (PubChem CID 54370728) has the molecular formula C17H12Cl2O3 and a molecular weight of 335.19 g/mol. Its IUPAC name is 5-[3-(3,5-dichlorophenoxy)phenyl]penta-2,4-dienoic acid.
| Compound Name | 5-[3-(3,5-dichlorophenoxy)phenyl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 54370728 |
| Molecular Formula | C17H12Cl2O3 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 5-[3-(3,5-dichlorophenoxy)phenyl]penta-2,4-dienoic acid |
| SMILES | O=C(O)C=CC=Cc1cccc(Oc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C17H12Cl2O3/c18-13-9-14(19)11-16(10-13)22-15-6-3-5-12(8-15)4-1-2-7-17(20)21/h1-11H,(H,20,21) |
| InChIKey | USZYEMBPSMQPPK-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|