C13H10Cl2N2O — CID 168529070
[3-(3,5-dichlorophenoxy)phenyl]methylidenehydrazine (PubChem CID 168529070) has the molecular formula C13H10Cl2N2O and a molecular weight of 281.14 g/mol. Its IUPAC name is [3-(3,5-dichlorophenoxy)phenyl]methylidenehydrazine.
| Compound Name | [3-(3,5-dichlorophenoxy)phenyl]methylidenehydrazine |
|---|---|
| PubChem CID | 168529070 |
| Molecular Formula | C13H10Cl2N2O |
| Molecular Weight | 281.14 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | [3-(3,5-dichlorophenoxy)phenyl]methylidenehydrazine |
| SMILES | NN=Cc1cccc(Oc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C13H10Cl2N2O/c14-10-5-11(15)7-13(6-10)18-12-3-1-2-9(4-12)8-17-16/h1-8H,16H2 |
| InChIKey | MEWPQZWYECJJOZ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.14 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|