C14H11Cl2NO — CID 932077
N-(3,5-dichlorophenyl)-1-(3-methoxyphenyl)methanimine (PubChem CID 932077) has the molecular formula C14H11Cl2NO and a molecular weight of 280.15 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-1-(3-methoxyphenyl)methanimine.
| Compound Name | N-(3,5-dichlorophenyl)-1-(3-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 932077 |
| Molecular Formula | C14H11Cl2NO |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | N-(3,5-dichlorophenyl)-1-(3-methoxyphenyl)methanimine |
| SMILES | COc1cccc(/C=N/c2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C14H11Cl2NO/c1-18-14-4-2-3-10(5-14)9-17-13-7-11(15)6-12(16)8-13/h2-9H,1H3/b17-9+ |
| InChIKey | MWFCLBHVMKTTAU-RQZCQDPDSA-N |
| XLogP | 4.75 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|