C20H15Cl2NO — CID 2197856
N-(3,5-dichlorophenyl)-1-(3-phenylmethoxyphenyl)methanimine (PubChem CID 2197856) has the molecular formula C20H15Cl2NO and a molecular weight of 356.25 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-1-(3-phenylmethoxyphenyl)methanimine.
| Compound Name | N-(3,5-dichlorophenyl)-1-(3-phenylmethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 2197856 |
| Molecular Formula | C20H15Cl2NO |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | N-(3,5-dichlorophenyl)-1-(3-phenylmethoxyphenyl)methanimine |
| SMILES | Clc1cc(Cl)cc(/N=C/c2cccc(OCc3ccccc3)c2)c1 |
| InChI | InChI=1S/C20H15Cl2NO/c21-17-10-18(22)12-19(11-17)23-13-16-7-4-8-20(9-16)24-14-15-5-2-1-3-6-15/h1-13H,14H2/b23-13+ |
| InChIKey | QFDPEIIWLLTOKU-YDZHTSKRSA-N |
| XLogP | 6.32 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|