C17H18O3S — CID 76929532
3-[5-(3-phenylpropoxymethyl)thiophen-3-yl]prop-2-enoic acid (PubChem CID 76929532) has the molecular formula C17H18O3S and a molecular weight of 302.40 g/mol. Its IUPAC name is 3-[5-(3-phenylpropoxymethyl)thiophen-3-yl]prop-2-enoic acid.
| Compound Name | 3-[5-(3-phenylpropoxymethyl)thiophen-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76929532 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 3-[5-(3-phenylpropoxymethyl)thiophen-3-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1csc(COCCCc2ccccc2)c1 |
| InChI | InChI=1S/C17H18O3S/c18-17(19)9-8-15-11-16(21-13-15)12-20-10-4-7-14-5-2-1-3-6-14/h1-3,5-6,8-9,11,13H,4,7,10,12H2,(H,18,19) |
| InChIKey | MFFXIBGXIFNXFY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|