C16H18ClNO3 — CID 115957095
(E)-3-[3-chloro-2-(4-cyano-4-methylpentoxy)phenyl]prop-2-enoic acid (PubChem CID 115957095) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is (E)-3-[3-chloro-2-(4-cyano-4-methylpentoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-chloro-2-(4-cyano-4-methylpentoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 115957095 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (E)-3-[3-chloro-2-(4-cyano-4-methylpentoxy)phenyl]prop-2-enoic acid |
| SMILES | CC(C)(C#N)CCCOc1c(Cl)cccc1/C=C/C(=O)O |
| InChI | InChI=1S/C16H18ClNO3/c1-16(2,11-18)9-4-10-21-15-12(7-8-14(19)20)5-3-6-13(15)17/h3,5-8H,4,9-10H2,1-2H3,(H,19,20)/b8-7+ |
| InChIKey | FIXSIAJKOSADCH-BQYQJAHWSA-N |
| XLogP | 4.15 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|